CAS 1821-36-9
:N-Cyclohexylbenzenamine
Description:
N-Cyclohexylbenzenamine, also known as cyclohexyl aniline, is an organic compound characterized by the presence of a cyclohexyl group attached to an aniline structure. It features a benzene ring bonded to an amine group (–NH2) and a cyclohexyl substituent, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic cyclohexyl group. N-Cyclohexylbenzenamine is primarily used in the synthesis of various chemicals, including dyes, pharmaceuticals, and rubber additives. It may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Additionally, it can participate in various chemical reactions, such as electrophilic aromatic substitution, due to the presence of the amino group, making it a valuable intermediate in organic synthesis.
Formula:C12H17N
InChI:InChI=1S/C12H17N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1,3-4,7-8,12-13H,2,5-6,9-10H2
InChI key:InChIKey=TXTHKGMZDDTZFD-UHFFFAOYSA-N
SMILES:N(C1CCCCC1)C2=CC=CC=C2
Synonyms:- Aniline, N-cyclohexyl-
- Benzenamine, N-cyclohexyl-
- Cyclohexanamine, N-phenyl-
- Cyclohexylamine, N-phenyl-
- Cyclohexylamine, N-phenyl- (8CI)
- Cyclohexylphenylamine
- Diphenylamine, ar-hexahydro-
- N-Cyclohexyl-N-phenylamine
- N-Cyclohexylbenzenamine
- N-Cyclohexylphenylamine
- N-Phenylcyclohexylamine
- Nsc 27510
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenamine, N-cyclohexyl-
CAS:Formula:C12H17NPurity:96%Color and Shape:LiquidMolecular weight:175.2701N-Cyclohexylaniline
CAS:N-CyclohexylanilineFormula:C12H17NPurity:97%Color and Shape: clear. light yellow liquidMolecular weight:175.27g/molN-Cyclohexylaniline
CAS:N-Cyclohexylaniline is a surface-active compound that is used to increase the water repellency of fabrics. It also has an important role in the polymerization process of some plastics and rubbers. N-Cyclohexylaniline is used in the production of anilines, amines, and other organic compounds. It can be used as a reaction initiator for the polymerization of various polymers, including polystyrene, polyurethane, and polyethylene terephthalate. N-Cyclohexylaniline has been shown to inhibit HIV infection by binding to gp120 and interfering with its ability to bind CD4 receptors on human cells. This compound may also have a coagulation effect on blood cells or it may be involved in the coagulation process.Formula:C12H17NPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:175.27 g/mol



