CAS 18212-21-0
:4-Methyl-1,2,3-thiadiazole-5-carboxylic acid
Description:
4-Methyl-1,2,3-thiadiazole-5-carboxylic acid is a heterocyclic organic compound characterized by a five-membered ring containing two nitrogen atoms and one sulfur atom, along with a carboxylic acid functional group. This compound features a methyl group at the 4-position of the thiadiazole ring, which influences its chemical reactivity and solubility. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, due to the presence of the carboxylic acid group. The compound exhibits properties typical of thiadiazoles, including potential biological activity, making it of interest in pharmaceutical and agricultural research. Its structure allows for various chemical modifications, which can enhance its efficacy in different applications. Additionally, 4-Methyl-1,2,3-thiadiazole-5-carboxylic acid can participate in various chemical reactions, such as esterification and amidation, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C4H4N2O2S
InChI:InChI=1S/C4H4N2O2S/c1-2-3(4(7)8)9-6-5-2/h1H3,(H,7,8)
InChI key:InChIKey=NHHQOYLPBUYHQU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)N=NS1
Synonyms:- 1,2,3-Thiadiazole-5-carboxylic acid, 4-methyl-
- 4-Methyl-1,2,3-Thiadiazole-5-Carboxylate
- Nk-F 001
- Sv 03
- 4-Methyl-1,2,3-thiadiazole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Methyl-1,2,3-thiadiazole-5-carboxylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H4N2O2SPurity:98%Color and Shape:Powder, White to creamMolecular weight:144.151,2,3-Thiadiazole-5-carboxylic acid, 4-methyl-
CAS:Formula:C4H4N2O2SPurity:97%Color and Shape:SolidMolecular weight:144.15184-Methyl-1,2,3-thiadiazole-5-carboxylic Acid
CAS:Formula:C4H4N2O2SPurity:>98.0%(GC)(T)Color and Shape:White to Brown powder to crystalMolecular weight:144.154-Methyl-1,2,3-thiadiazole-5-carboxylic acid
CAS:Formula:C4H4N2O2SColor and Shape:NeatMolecular weight:144.154-Methyl-1,2,3-thiadiazole-5-carboxylic acid
CAS:4-Methyl-1,2,3-thiadiazole-5-carboxylic acidFormula:C4H4N2O2SPurity:98%Color and Shape: faint orange powderMolecular weight:144.15g/mol4-Methyl-1,2,3-thiadiazole-5-carboxylic acid
CAS:Formula:C4H4N2O2SPurity:97%Color and Shape:SolidMolecular weight:144.154-Methyl-1,2,3-thiadiazole-5-carboxylic Acid
CAS:Controlled ProductApplications 4-Methyl-1,2,3-Thiadiazole-5-Carboxylic Acid (cas# 18212-21-0) is a useful research chemical.
Formula:C4H4N2O2SColor and Shape:WhiteMolecular weight:144.15






