CAS 182128-53-6

7-Chloro-N-(4-chlorophenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide

Description:

7-Chloro-N-(4-chlorophenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide, with the CAS number 182128-53-6, is a chemical compound characterized by its complex structure, which includes a benzothiazine core. This compound features a chloro substituent at the 7-position and an N-(4-chlorophenyl) group, contributing to its potential biological activity. The presence of the carboxamide functional group suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and reactivity. The benzothiazine moiety is known for its pharmacological significance, often being explored for its potential therapeutic applications, including anti-inflammatory and analgesic effects. The chlorinated phenyl group may enhance the compound's lipophilicity, potentially affecting its bioavailability and interaction with biological targets. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₅H₁₂Cl₂N₂OS

InChI: InChI=1S/C15H12Cl2N2OS/c16-10-1-4-12(5-2-10)18-15(20)19-7-8-21-14-9-11(17)3-6-13(14)19/h1-6,9H,7-8H2,(H,18,20)

InChI key: InChIKey=UVVGXPFNNMDNSR-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(Cl)C=C1)(=O)N2C=3C(SCC2)=CC(Cl)=CC3

Synonyms:

• 7-Chloro-N-(4-chlorophenyl)-2,3-dihydro-4H-1,4-benzothiazine-4-carboxamide
• 4H-1,4-Benzothiazine-4-carboxamide, 7-chloro-N-(4-chlorophenyl)-2,3-dihydro-