CAS 18213-76-8

7-methyl-6,7-dihydro-4H-pyrazolo[3,4-d][1,2,3]triazin-4-one

Description:

7-methyl-6,7-dihydro-4H-pyrazolo[3,4-d][1,2,3]triazin-4-one, with the CAS number 18213-76-8, is a heterocyclic organic compound characterized by a fused pyrazole and triazine ring system. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. Its structure includes a methyl group at the 7-position and a carbonyl group at the 4-position, contributing to its reactivity and potential biological activity. The presence of nitrogen atoms in the ring system often imparts unique properties, such as the ability to form hydrogen bonds, which can influence its interactions in biological systems. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory or antimicrobial activities. However, specific applications and biological effects would depend on further research and characterization. As with many heterocycles, it may also serve as a building block for the synthesis of more complex molecules in organic synthesis.

Formula: C₅H₅N₅O

InChI: InChI=1/C5H5N5O/c1-10-4-3(2-6-10)5(11)8-9-7-4/h2,6H,1H3

SMILES: Cn1c2c(c[nH]1)c(=O)nnn2

7-Methyl-3H,4H,7H-pyrazolo[3,4-d][1,2,3]triazin-4-one

CAS: 18213-76-8

Versatile small molecule scaffold

Formula: C₅H₅N₅O

Purity: Min. 95%

Molecular weight: 151.13 g/mol

Ref: 3D-TAA21376