CAS 182137-57-1

1,1-Dimethylethyl 1-(hydroxymethyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate

Description:

1,1-Dimethylethyl 1-(hydroxymethyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate, with CAS number 182137-57-1, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring system, indicative of its classification as an azabicyclic compound. The presence of a carboxylate group suggests it has acidic properties, while the hydroxymethyl group indicates potential for hydrogen bonding and reactivity. The dimethyl groups contribute to steric hindrance, which can influence the compound's reactivity and interactions with other molecules. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity would depend on the specific functional groups and the overall molecular conformation. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use.

Formula: C₁₂H₂₁NO₃

InChI: InChI=1S/C12H21NO3/c1-11(2,3)16-10(15)13-9-4-6-12(13,8-14)7-5-9/h9,14H,4-8H2,1-3H3

InChI key: InChIKey=LRNLIMHUUCUPDJ-UHFFFAOYSA-N

SMILES: C(O)C12N(C(OC(C)(C)C)=O)C(CC1)CC2

Synonyms:

• 1,1-Dimethylethyl 1-(hydroxymethyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate
• tert-Butyl 1-(hydroxymethyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate
• 7-Azabicyclo[2.2.1]heptane-7-carboxylic acid, 1-(hydroxymethyl)-, 1,1-dimethylethyl ester

tert-Butyl 1-(hydroxymethyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate

CAS: 182137-57-1

tert-Butyl 1-(hydroxymethyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate

Purity: 98%

Molecular weight: 227.3g/mol

Ref: 54-OR1033400

tert-Butyl 1-(hydroxymethyl)-7-azabicyclo[2.2.1]heptane-7-carboxylate

CAS: 182137-57-1

Purity: 98%

Molecular weight: 227.3040009

Ref: 10-F719775