CAS 1821370-71-1

6-(5-Carboxy-2-thiazolyl)-3-pyridinecarboxylic acid

Description:

6-(5-Carboxy-2-thiazolyl)-3-pyridinecarboxylic acid, identified by its CAS number 1821370-71-1, is a heterocyclic organic compound featuring both pyridine and thiazole moieties. This compound is characterized by the presence of carboxylic acid functional groups, which contribute to its acidity and potential for forming salts and esters. The thiazole ring imparts unique electronic properties, making it useful in various chemical reactions and applications. The compound is likely to exhibit polar characteristics due to the presence of multiple functional groups, influencing its solubility in polar solvents. Additionally, the structural arrangement suggests potential biological activity, which may be explored in pharmaceutical research. Its synthesis and reactivity can be of interest in organic chemistry, particularly in the development of new materials or biologically active compounds. Overall, this compound represents a valuable structure for further investigation in both synthetic and medicinal chemistry contexts.

Formula: C₁₀H₆N₂O₄S

InChI: InChI=1S/C10H6N2O4S/c13-9(14)5-1-2-6(11-3-5)8-12-4-7(17-8)10(15)16/h1-4H,(H,13,14)(H,15,16)

InChI key: InChIKey=ISYUGJYTQIZJHV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1SC(=NC1)C2=CC=C(C(O)=O)C=N2

Synonyms:

• 6-(5-Carboxy-2-thiazolyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 6-(5-carboxy-2-thiazolyl)-
• 2-(5-Carboxythiazol-2-yl)pyridine-5-carboxylic acid
• pythiDC

PythiDC

CAS: 1821370-71-1

PythiDC

Purity: ≥98%

Molecular weight: 250.23g/mol

Ref: 54-BUP06610

PythiDC

CAS: 1821370-71-1

PythiDC is a selective collagen prolyl 4-hydroxylase inhibitor, neither causing general toxicity nor disrupting iron homeostasis.

Formula: C₁₀H₆N₂O₄S

Purity: 98.13%

Color and Shape: Solid

Molecular weight: 250.23

Ref: TM-T8988

Pythidc

CAS: 1821370-71-1

Pythidc is a fungal inhibitor, which is derived from naturally occurring compounds with antimicrobial properties. This compound is isolated from specific plant metabolites through a series of extraction and purification processes. Its mode of action involves disrupting the cell membrane integrity of pathogenic fungi, thereby inhibiting their growth and proliferation. By targeting essential components of the fungal cell structure, Pythidc interferes with cell membrane synthesis and function, leading to cell lysis.

Formula: C₁₀H₆N₂O₄S

Purity: Min. 95%

Molecular weight: 250.23 g/mol

Ref: 3D-WXC37071