CymitQuimica logo

CAS 182159-58-6

:

3-Pyridinecarboxamide,6-(aminomethyl)-(9CI)

Description:
3-Pyridinecarboxamide, 6-(aminomethyl)-(9CI), also known by its CAS number 182159-58-6, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxamide functional group at the 3-position and an aminomethyl group at the 6-position of the pyridine ring. The presence of these functional groups suggests that it may exhibit properties such as hydrogen bonding and potential reactivity in various chemical reactions. It is likely to be soluble in polar solvents due to the amide and amine functionalities, which can engage in dipole-dipole interactions and hydrogen bonding. The compound may also have biological significance, as many pyridine derivatives are known for their pharmacological activities. However, specific applications, toxicity, and safety data would require further investigation and should be referenced from reliable chemical databases or literature for comprehensive understanding.
Formula:C7H9N3O
InChI:InChI=1S/C7H9N3O/c8-3-6-2-1-5(4-10-6)7(9)11/h1-2,4H,3,8H2,(H2,9,11)
InChI key:FAXYPRPMUNHQLC-UHFFFAOYSA-N
SMILES:C1=CC(=NC=C1C(=O)N)CN
Found 0 products.