CAS 18216-74-5

5-Phenyl-2-hexanone

Description:

5-Phenyl-2-hexanone, with the CAS number 18216-74-5, is an organic compound classified as a ketone. It features a six-carbon chain with a phenyl group attached to the fifth carbon and a ketone functional group at the second carbon. This structure contributes to its unique chemical properties, including its reactivity and solubility characteristics. Typically, 5-Phenyl-2-hexanone is a colorless to pale yellow liquid with a distinctive odor, making it useful in various applications, including as a flavoring agent and in the synthesis of other organic compounds. The compound is known for its moderate volatility and can be soluble in organic solvents while having limited solubility in water. Its chemical behavior is influenced by the presence of the carbonyl group, which can participate in various reactions such as nucleophilic addition. Safety data indicates that, like many ketones, it should be handled with care due to potential irritant properties and the need for proper ventilation during use.

Formula: C₁₂H₁₆O

InChI: InChI=1S/C12H16O/c1-10(8-9-11(2)13)12-6-4-3-5-7-12/h3-7,10H,8-9H2,1-2H3

InChI key: InChIKey=UBTPKYDISLNBLJ-UHFFFAOYSA-N

SMILES: C(CCC(C)=O)(C)C1=CC=CC=C1

Synonyms:

• 5-Phenyl-2-hexanone
• 2-Hexanone, 5-phenyl-