CymitQuimica logo

CAS 18217-12-4

:

5-METHYL-2-HEPTANONE

Description:
5-Methyl-2-heptanone is a ketone with the molecular formula C8H16O, characterized by a carbonyl group (C=O) located at the second carbon of a heptane chain, with a methyl group attached to the fifth carbon. This compound is a colorless liquid at room temperature and has a distinctive odor, often described as fruity or sweet. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic hydrocarbon chain. 5-Methyl-2-heptanone is used in various applications, including as a solvent and in the synthesis of other organic compounds. Its properties include a moderate boiling point and a relatively low vapor pressure, making it stable under standard conditions. As with many ketones, it can participate in various chemical reactions, including oxidation and reduction, and may pose health risks if inhaled or ingested, necessitating proper handling and safety precautions in laboratory and industrial settings.
Formula:C8H16O
InChI:InChI=1/C8H16O/c1-4-7(2)5-6-8(3)9/h7H,4-6H2,1-3H3
InChI key:WYDAUGNQLUXTFB-UHFFFAOYSA-N
SMILES:CCC(C)CCC(=O)C
Synonyms:
  • 5-Methylheptan-2-One
Found 4 products.