CAS 1821908-49-9

Propanamide, 2-amino-N-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]-, hydrochloride (1:1), (2S)-

Description:

Propanamide, 2-amino-N-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]-, hydrochloride (1:1), (2S)- is a chemical compound characterized by its amide functional group, which is indicative of its potential as a pharmaceutical agent. The presence of the amino group suggests it may exhibit basic properties, while the hydrochloride form indicates it is a salt, enhancing its solubility in water. The compound features a complex structure with a propanamide backbone and a substituted aromatic system, which includes a dimethylphenoxy group and a methylphenyl moiety. This structural complexity may contribute to its biological activity, potentially influencing interactions with biological targets. The (2S)- designation indicates its specific stereochemistry, which can be crucial for its pharmacological effects. As with many compounds of this nature, its characteristics, including solubility, stability, and reactivity, are influenced by its molecular structure, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₁₉H₂₄N₂O₂·ClH

InChI: InChI=1S/C19H24N2O2.ClH/c1-12-7-13(2)9-17(8-12)23-18-6-5-16(10-14(18)3)11-21-19(22)15(4)20;/h5-10,15H,11,20H2,1-4H3,(H,21,22);1H/t15-;/m0./s1

InChI key: InChIKey=OQGSBQJSJRLNQH-RSAXXLAASA-N

SMILES: O(C1=CC(C)=CC(C)=C1)C2=C(C)C=C(CNC([C@H](C)N)=O)C=C2.Cl

Synonyms:

• Propanamide, 2-amino-N-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]-, hydrochloride (1:1), (2S)-

SGC2085 HCl

CAS: 1821908-49-9

SGC2085 HCl

Purity: ≥98%

Molecular weight: 348.87g/mol

Ref: 54-BUP05326

SGC2085 HCl

CAS: 1821908-49-9

SGC2085: potent, selective CARM1 inhibitor; IC50=50 nM; >100x selectivity vs other PRMTs; impacts cancer growth.

Formula: C₁₉H₂₄N₂O₂·HCl

Purity: 99.91%

Color and Shape: Solid

Molecular weight: 348.87

Ref: TM-T4013

SGC2085 Hydrochloride

CAS: 1821908-49-9

SGC2085 Hydrochloride is a selective inhibitor, which is a chemically synthesized compound designed to specifically target and inhibit certain biological processes. This inhibitor is derived from small molecule chemical synthesis and acts by selectively binding to its target, thereby modulating its biological activity.

Formula: C₁₉H₂₄N₂O₂•HCl

Purity: Min. 95%

Molecular weight: 312.41 g/mol

Ref: 3D-WXC90849