CAS 182198-35-2
:4-CHLORO-5-PHENYLTHIENO[2,3-D]PYRIMIDINE
Description:
4-Chloro-5-phenylthieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its fused thieno and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and a phenyl group at the 5-position enhances its reactivity and potential biological activity. This compound typically exhibits moderate solubility in organic solvents, while its solubility in water is generally low due to its hydrophobic nature. It may display various pharmacological activities, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The molecular structure allows for potential interactions with biological targets, which can be explored in drug design. Additionally, its stability under standard laboratory conditions is an important characteristic for handling and storage. As with many heterocycles, the electronic properties of the compound can be influenced by substituents, affecting its reactivity and interaction with other molecules. Overall, 4-chloro-5-phenylthieno[2,3-d]pyrimidine is a compound of interest in both synthetic and medicinal chemistry.
Formula:C12H7ClN2S
InChI:InChI=1/C12H7ClN2S/c13-11-10-9(8-4-2-1-3-5-8)6-16-12(10)15-7-14-11/h1-7H
SMILES:c1ccc(cc1)c1csc2c1c(Cl)ncn2
Synonyms:- Akos 90534
- Akos Ncg-0083
- Akos Bbs-00006350
- Buttpark 30\08-39
- Thieno[2,3-D]Pyrimidine, 4-Chloro-5-Phenyl-
- Otava-Bb Bb7012780011
- 4-CHLORO-5-PHENYLTHIENO[2,3-D]PYRIMIDINE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-5-phenylthieno[2,3-d]pyrimidine, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C12H7ClN2SPurity:98%Molecular weight:246.724-Chloro-5-phenylthieno[2,3-d]pyrimidine
CAS:Formula:C12H7ClN2SPurity:97%Color and Shape:SolidMolecular weight:246.71544-Chloro-5-phenylthieno[2,3-d]pyrimidine
CAS:4-Chloro-5-phenylthieno[2,3-d]pyrimidinePurity:≥95%Color and Shape:SolidMolecular weight:246.72g/mol4-Chloro-5-phenyl-thieno[2,3-d]pyrimidine
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:246.7100067138672



