CAS 1822-66-8
:3,4-Dihydroxythiophene-2,5-dicarboxylic acid diethyl ester
Description:
3,4-Dihydroxythiophene-2,5-dicarboxylic acid diethyl ester, with CAS number 1822-66-8, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features two hydroxyl (-OH) groups and two carboxylic acid ester groups, contributing to its reactivity and solubility in various solvents. The presence of the diethyl ester groups enhances its lipophilicity, making it more soluble in organic solvents compared to its acid form. The hydroxyl groups can participate in hydrogen bonding, influencing its physical properties such as melting point and boiling point. This compound is of interest in organic synthesis and materials science, particularly in the development of conductive polymers and dyes due to its ability to undergo oxidation and polymerization. Additionally, its structural features may impart antioxidant properties, making it a candidate for various applications in pharmaceuticals and agrochemicals. Overall, 3,4-Dihydroxythiophene-2,5-dicarboxylic acid diethyl ester is a versatile compound with significant potential in both research and industrial applications.
Formula:C10H12O6S
InChI:InChI=1/C10H12O6S/c1-3-15-9(13)7-5(11)6(12)8(17-7)10(14)16-4-2/h11-12H,3-4H2,1-2H3
Synonyms:- (2Z)-2,5-bis[ethoxy(hydroxy)methylidene]thiophene-3,4(2H,5H)-dione
- Diethyl 3,4-Dihydroxythiophene-2,5-Dicarboxylate
- 2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, 2,5-diethyl ester
- 3,4-Dihydroxy-Thiophene-2,5-Dicarboxylic Acid Diethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, 2,5-diethyl ester
CAS:Formula:C10H12O6SPurity:98%Color and Shape:SolidMolecular weight:260.2637Diethyl 3,4-dihydroxythiophene-2,5-dicarboxylate
CAS:Diethyl 3,4-dihydroxythiophene-2,5-dicarboxylatePurity:97%Molecular weight:260.26g/mol3,4-Dihydroxythiophene-2,5-dicarboxylic aciddiethyl ester
CAS:Formula:C10H12O6SPurity:95%Color and Shape:SolidMolecular weight:260.26


