CAS 182247-45-6
:(S)-2-Benzylsuccinic acid-1-methyl ester
Description:
(S)-2-Benzylsuccinic acid-1-methyl ester is an organic compound characterized by its chiral structure, which includes a benzyl group and a methyl ester functional group. This compound belongs to the class of succinic acid derivatives and is notable for its potential applications in pharmaceuticals and organic synthesis. The presence of the chiral center contributes to its stereoisomerism, which can influence its biological activity and reactivity. Typically, such compounds exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic benzyl group. The methyl ester functionality allows for reactivity in esterification and hydrolysis reactions, making it a versatile intermediate in synthetic chemistry. Additionally, the compound's specific stereochemistry can affect its interaction with biological systems, which is crucial for drug development. Overall, (S)-2-Benzylsuccinic acid-1-methyl ester is a valuable compound in the field of organic chemistry, particularly in the synthesis of more complex molecules.
Formula:C12H14O4
InChI:InChI=1/C12H14O4/c1-16-12(15)10(8-11(13)14)7-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,13,14)/t10-/m0/s1
SMILES:COC(=O)[C@@H](Cc1ccccc1)CC(=O)O
Synonyms:- (S)-(-)-3-Methoxycarbonyl-4-phenylbutyric acid
- (3S)-3-benzyl-4-methoxy-4-oxobutanoate
- (3S)-3-benzyl-4-methoxy-4-oxobutanoic acid
- (S)-(-)-2-Benzylsuccinic acid 1-methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-(-)-2-Benzylsuccinic acid 1-methyl ester, 98+%, ee 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C12H13O4Purity:98+%Color and Shape:Clear to turbid yellow, Viscous liquidMolecular weight:221.23Butanedioic acid, 2-(phenylmethyl)-, 1-methyl ester, (2S)-
CAS:Formula:C12H14O4Purity:95%Color and Shape:LiquidMolecular weight:222.2372




