CAS 182282-60-6
:9-ethyl-2-methoxy-7-methyl-5-propylimidazo[1,5-a]pyrido[3,2-e]pyrazin-6(5H)-one
Description:
9-ethyl-2-methoxy-7-methyl-5-propylimidazo[1,5-a]pyrido[3,2-e]pyrazin-6(5H)-one, with the CAS number 182282-60-6, is a complex organic compound characterized by its unique bicyclic structure that incorporates both imidazole and pyrazine moieties. This compound features multiple substituents, including ethyl, methoxy, methyl, and propyl groups, which contribute to its chemical properties and potential biological activity. The presence of these alkyl groups can influence the compound's solubility, stability, and reactivity. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The specific arrangement of atoms and functional groups in this molecule can lead to diverse interactions with biological targets, potentially affecting enzyme activity or receptor binding. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for structural elucidation. Overall, the unique structural features of this compound suggest potential applications in drug development or as a research tool in biochemistry.
Formula:C16H20N4O2
InChI:InChI=1/C16H20N4O2/c1-5-9-19-11-7-8-13(22-4)18-15(11)20-12(6-2)17-10(3)14(20)16(19)21/h7-8H,5-6,9H2,1-4H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
D 22888
CAS:<p>D 22888 is a PDE4 inhibitor.</p>Formula:C16H20N4O2Color and Shape:SolidMolecular weight:300.36
