CAS 182282-60-6

9-ethyl-2-methoxy-7-methyl-5-propylimidazo[1,5-a]pyrido[3,2-e]pyrazin-6(5H)-one

Description:

9-ethyl-2-methoxy-7-methyl-5-propylimidazo[1,5-a]pyrido[3,2-e]pyrazin-6(5H)-one, with the CAS number 182282-60-6, is a complex organic compound characterized by its unique bicyclic structure that incorporates both imidazole and pyrazine moieties. This compound features multiple substituents, including ethyl, methoxy, methyl, and propyl groups, which contribute to its chemical properties and potential biological activity. The presence of these alkyl groups can influence the compound's solubility, stability, and reactivity. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The specific arrangement of atoms and functional groups in this molecule can lead to diverse interactions with biological targets, potentially affecting enzyme activity or receptor binding. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for structural elucidation. Overall, the unique structural features of this compound suggest potential applications in drug development or as a research tool in biochemistry.

Formula: C₁₆H₂₀N₄O₂

InChI: InChI=1/C16H20N4O2/c1-5-9-19-11-7-8-13(22-4)18-15(11)20-12(6-2)17-10(3)14(20)16(19)21/h7-8H,5-6,9H2,1-4H3

D 22888

CAS: 182282-60-6

D 22888 is a PDE4 inhibitor.

Formula: C₁₆H₂₀N₄O₂

Color and Shape: Solid

Molecular weight: 300.36

Ref: TM-T70140