CAS 182287-70-3

4-(Aminomethyl)-2-methoxybenzonitrile

Description:

4-(Aminomethyl)-2-methoxybenzonitrile, with the CAS number 182287-70-3, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a nitrile functional group. This compound features an amino group (-NH2) attached to a benzene ring, specifically at the para position relative to the methoxy group. The presence of the nitrile group (-C≡N) contributes to its reactivity and potential applications in organic synthesis. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, its physical properties, such as melting point and solubility, would depend on the specific conditions and purity of the sample. Overall, 4-(Aminomethyl)-2-methoxybenzonitrile is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₉H₁₀N₂O

InChI: InChI=1S/C9H10N2O/c1-12-9-4-7(5-10)2-3-8(9)6-11/h2-4H,5,10H2,1H3

InChI key: InChIKey=ODJRWUOXUGLZHT-UHFFFAOYSA-N

SMILES: O(C)C1=C(C#N)C=CC(CN)=C1

Synonyms:

• Benzonitrile, 4-(aminomethyl)-2-methoxy-
• 4-(Aminomethyl)-2-methoxybenzonitrile

4-(Aminomethyl)-2-methoxybenzonitrile

CAS: 182287-70-3

Versatile small molecule scaffold

Formula: C₉H₁₀N₂O

Purity: Min. 95%

Molecular weight: 162.19 g/mol

Ref: 3D-HHA28770