CymitQuimica logo

CAS 182289-81-2

:

4-Fluoro-2-Nitrobenzotrifluoride

Description:
4-Fluoro-2-Nitrobenzotrifluoride, with the CAS number 182289-81-2, is an aromatic compound characterized by the presence of a nitro group and multiple fluorine substituents on a benzene ring. This compound features a trifluoromethyl group (-CF3) and a nitro group (-NO2) positioned at the 2 and 4 positions, respectively, relative to the fluorine atom. It is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. The presence of electronegative fluorine and nitro groups contributes to its high polarity and potential reactivity, making it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, its unique structure may impart specific physical properties such as increased stability and solubility in organic solvents. Safety precautions are necessary when handling this compound, as it may pose health risks due to its toxic and potentially hazardous nature. Proper storage and disposal methods should be followed to mitigate environmental impact.
Formula:C7H3F4NO2
InChI:InChI=1/C7H3F4NO2/c8-4-1-2-5(7(9,10)11)6(3-4)12(13)14/h1-3H
InChI key:RYWITRIDDKRWBT-UHFFFAOYSA-N
SMILES:c1cc(c(cc1F)N(=O)=O)C(F)(F)F
Synonyms:
  • 4-Fluoro-2-Nitro-1-(Trifluoromethyl)Benzene
Found 3 products.