CAS 182292-07-5

α-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-methylcyclohexaneacetic acid

Description:

α-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-methylcyclohexaneacetic acid, with CAS number 182292-07-5, is a chemical compound characterized by its unique structure that includes a cyclohexane ring, an amino group, and a carboxylic acid functional group. This compound features a dimethylethoxycarbonyl protective group, which is often used in organic synthesis to protect amines during chemical reactions. The presence of the 4-methyl group on the cyclohexane ring contributes to its steric properties, influencing its reactivity and interactions with other molecules. The carboxylic acid functionality allows for potential hydrogen bonding and solubility in polar solvents, making it useful in various chemical applications, including pharmaceuticals and organic synthesis. Additionally, the compound's specific stereochemistry and functional groups may impart biological activity, making it of interest in medicinal chemistry. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and application.

Formula: C₁₄H₂₅NO₄

InChI: InChI=1S/C14H25NO4/c1-9-5-7-10(8-6-9)11(12(16)17)15-13(18)19-14(2,3)4/h9-11H,5-8H2,1-4H3,(H,15,18)(H,16,17)

InChI key: InChIKey=MUOXYNIOJBUOCL-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(C(O)=O)C1CCC(C)CC1

Synonyms:

• 2-[[(tert-Butoxy)carbonyl]amino]-2-(4-methylcyclohexyl)acetic acid
• α-[[(1,1-Dimethylethoxy)carbonyl]amino]-4-methylcyclohexaneacetic acid
• Cyclohexaneacetic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-4-methyl-

2-([(tert-Butoxy)carbonyl]amino)-2-(4-methylcyclohexyl)acetic acid

CAS: 182292-07-5

Versatile small molecule scaffold

Formula: C₁₄H₂₅NO₄

Purity: Min. 95%

Molecular weight: 271.35 g/mol

Ref: 3D-HHA29207