CAS 1823182-58-6

4-Chloro-5-(methylsulfonyl)quinoline

Description:

4-Chloro-5-(methylsulfonyl)quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a chlorine atom at the 4-position and a methylsulfonyl group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in medicinal chemistry due to its potential biological activities, which may include antimicrobial or anticancer properties. The methylsulfonyl group can enhance the compound's solubility and bioavailability, making it a candidate for further pharmacological studies. Additionally, the chlorine substituent can influence the compound's reactivity and interaction with biological targets. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks or environmental hazards.

Formula: C₁₀H₈ClNO₂S

InChI: InChI=1S/C10H8ClNO2S/c1-15(13,14)9-4-2-3-8-10(9)7(11)5-6-12-8/h2-6H,1H3

InChI key: InChIKey=HHRCCDXHJSJKTR-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C=1C2=C(N=CC=C2Cl)C=CC1

Synonyms:

• Quinoline, 4-chloro-5-(methylsulfonyl)-
• 4-Chloro-5-(methylsulfonyl)quinoline

4-Chloro-5-(methylsulfonyl)quinoline

CAS: 1823182-58-6

4-Chloro-5-(methylsulfonyl)quinoline

Molecular weight: 241.69g/mol

Ref: 54-OR311263