CAS 18233-70-0
:Monoacetyl-1,4-diaminobutane hydrochloride
Description:
Monoacetyl-1,4-diaminobutane hydrochloride, with the CAS number 18233-70-0, is a chemical compound characterized by its structure, which includes an acetyl group attached to a 1,4-diaminobutane backbone. This compound typically appears as a white to off-white crystalline solid and is soluble in water, which is a common trait for many hydrochloride salts. The presence of amino groups in its structure suggests that it may participate in various chemical reactions, including acylation and amination. Monoacetyl-1,4-diaminobutane hydrochloride is often utilized in biochemical research and pharmaceutical applications, particularly in the synthesis of more complex molecules or as an intermediate in drug development. Its hydrochloride form enhances its stability and solubility, making it easier to handle in laboratory settings. As with many amines, it may exhibit basic properties, and its reactivity can be influenced by the presence of the acetyl group, which can modulate its nucleophilicity and overall chemical behavior.
Formula:C6H14N2O·ClH
InChI:InChI=1S/C6H14N2O.ClH/c1-6(9)8-5-3-2-4-7;/h2-5,7H2,1H3,(H,8,9);1H
InChI key:InChIKey=XBECFEJUQZXMFE-UHFFFAOYSA-N
SMILES:C(NC(C)=O)CCCN.Cl
Synonyms:- N-(4-aminobutyl)acetamide
- Monoacetyl-1,4-diaminobutane hydrochloride
- N-(4-aminobutyl)acetamide hydrochloride
- Acetamide, N-(4-aminobutyl)-, hydrochloride
- Acetamide, N-(4-aminobutyl)-, hydrochloride (1:1)
- N-(4-Aminobutyl)acetamide hydrochloride
- Acetamide, N-(4-aminobutyl)-, monohydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Acetamide, N-(4-aminobutyl)-, hydrochloride (1:1)
CAS:Formula:C6H15ClN2OPurity:95%Color and Shape:LiquidMolecular weight:166.6491N-(4-Aminobutyl)Acetamide Hydrochloride
CAS:N-(4-Aminobutyl)Acetamide HydrochloridePurity:95%Molecular weight:166.65g/molN-Acetylputrescine hydrochloride
CAS:N-Acetylputrescine hydrochloridePurity:≥98%Molecular weight:166.65g/molN-Acetylputrescine hydrochloride
CAS:N-Acetylputrescine is a polyamine commonly occurring excreted in normal human urineFormula:C6H15ClN2OPurity:99.36%Color and Shape:SolidMolecular weight:166.65N-Acetylputrescine hydrochloride
CAS:N-Acetylputrescine hydrochloride is an amino acid derivative that has been shown to have a trophic effect on the gut and to inhibit cancer. The compound is currently being studied as a potential treatment for cancer. N-Acetylputrescine hydrochloride inhibits the growth of intestinal cancer cells by blocking the growth of new blood vessels in tumors, which stops tumor growth and leads to regression. N-Acetylputrescine hydrochloride also stimulates the immune system by increasing T cell levels in the colon, which promotes immunosurveillance and may lead to regression of tumor cells.Formula:C6H14N2O•HClPurity:Min. 95%Molecular weight:166.65 g/mol




