CAS 182344-13-4
:3-Chloro-4-hydroxyphenylboronic acid
Description:
3-Chloro-4-hydroxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a chlorinated phenyl ring, which enhances its reactivity and solubility in organic solvents. The hydroxyl group on the phenyl ring contributes to its potential as a ligand in various chemical reactions, particularly in Suzuki coupling reactions, which are pivotal in organic synthesis for forming carbon-carbon bonds. The boronic acid moiety allows for the formation of stable complexes with sugars and other biomolecules, making it useful in biochemical applications. Additionally, the compound's structural features may impart specific biological activities, making it of interest in medicinal chemistry. Its solubility in water and organic solvents, along with its moderate stability under standard laboratory conditions, further define its utility in research and industrial applications. Safety data should be consulted for handling, as with all chemical substances.
Formula:C6H6BClO3
InChI:InChI=1/C6H6BClO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9-11H
SMILES:c1cc(c(cc1B(O)O)Cl)O
Synonyms:- (3-Chloro-4-hydroxyphenyl)boronic acid
- boronic acid, B-(3-chloro-4-hydroxyphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Boronic acid, B-(3-chloro-4-hydroxyphenyl)-
CAS:Formula:C6H6BClO3Purity:98%Color and Shape:SolidMolecular weight:172.37403-Chloro-4-hydroxybenzeneboronic acid
CAS:3-Chloro-4-hydroxybenzeneboronic acid
Formula:C6H6BClO3Purity:98%Color and Shape: white solidMolecular weight:172.37g/mol(3-Chloro-4-hydroxyphenyl)boronic acid
CAS:Formula:C6H6BClO3Purity:95%Color and Shape:SolidMolecular weight:172.373-Chloro-4-hydroxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H6BClO3Purity:97.0 to 112.0 %Color and Shape:White to Light yellow to Light red powder to crystalMolecular weight:172.37



