CAS 182344-14-5
:(3-Fluoro-4-Hydroxyphenyl)Boronic Acid
Description:
(3-Fluoro-4-Hydroxyphenyl)Boronic Acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has both a hydroxyl group and a fluorine substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and having moderate stability under standard conditions. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity or altering its biological activity. Additionally, the hydroxyl group contributes to hydrogen bonding capabilities, which can affect solubility and interaction with biological targets. Overall, (3-Fluoro-4-Hydroxyphenyl)Boronic Acid is a versatile compound with applications in pharmaceuticals and materials science, particularly in the development of boron-containing drugs and ligands.
Formula:C6H6BFO3
InChI:InChI=1/C6H6BFO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9-11H
SMILES:c1cc(c(cc1B(O)O)F)O
Synonyms:- Akos Brn-0728
- 3-Fluoro-4-Hydroxybenzeneboronic Acid
- Boronic acid, (3-fluoro-4-hydroxyphenyl)-
- 3-Fluoro-4-hydroxybenzeneboronicacid
- 4-Borono-2-fluorophenol
- 3-Fluoro-4-hydroxyphenylboronicAcid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Fluoro-4-hydroxybenzeneboronic acid, 97%
CAS:3-Fluoro-4-hydroxybenzeneboronic acid is used as intermediates. Hydroxybenzene boronic acids are involved in suzuki miyaura reactions. It is a arylboronic acid. 3-Fluoro-4-hydroxybenzeneboronic acid, can be an effective catalyst for amidation and esterification of carboxylic acids. This Thermo Scie
Formula:C6H6BFO3Purity:97%Molecular weight:155.92Boronic acid, B-(3-fluoro-4-hydroxyphenyl)-
CAS:Formula:C6H6BFO3Purity:96%Color and Shape:SolidMolecular weight:155.91943-Fluoro-4-hydroxybenzeneboronic acid
CAS:3-Fluoro-4-hydroxybenzeneboronic acidFormula:C6H6BFO3Purity:97%Color and Shape: white powderMolecular weight:155.92g/mol3-Fluoro-4-hydroxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H6BFO3Color and Shape:White to Light yellow powder to crystalMolecular weight:155.923-Fluoro-4-hydroxyphenylboronic acid
CAS:Formula:C6H6BFO3Purity:96%Color and Shape:Solid, White powderMolecular weight:155.92




