CAS 182344-18-9
:2-Chloro-5-(trifluoromethyl)benzeneboronic acid
Description:
2-Chloro-5-(trifluoromethyl)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its reactivity in various organic synthesis applications, particularly in Suzuki coupling reactions. This compound features a chlorinated aromatic ring and a trifluoromethyl group, which can significantly influence its electronic properties and reactivity. The presence of the boronic acid moiety allows for the formation of stable complexes with diols and other Lewis bases, making it useful in the development of pharmaceuticals and agrochemicals. Additionally, the trifluoromethyl group enhances lipophilicity and can improve the biological activity of the compound. The compound is typically handled with care due to its potential reactivity and the presence of chlorine and fluorine atoms, which can pose environmental and health risks. Overall, 2-Chloro-5-(trifluoromethyl)benzeneboronic acid is a valuable intermediate in synthetic organic chemistry, particularly in the field of medicinal chemistry.
Formula:C7H5BClF3O2
InChI:InChI=1/C7H5BClF3O2/c9-6-2-1-4(7(10,11)12)3-5(6)8(13)14/h1-3,13-14H
SMILES:c1cc(c(cc1C(F)(F)F)B(O)O)Cl
Synonyms:- 2-Chloro-5-(trifluoromethyl)phenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Chloro-5-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H5BClF3O2Purity:97.0 to 109.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:224.372-Chloro-5-(trifluoromethyl)benzeneboronic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5BClF3O2Purity:96%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:224.37Boronic acid, B-[2-chloro-5-(trifluoromethyl)phenyl]-
CAS:Formula:C7H5BClF3O2Purity:97%Color and Shape:SolidMolecular weight:224.37262-Chloro-5-(trifluoromethyl)benzeneboronic acid
CAS:2-Chloro-5-(trifluoromethyl)benzeneboronic acidFormula:C7H5BClF3O2Purity:98%Color and Shape: white solidMolecular weight:224.37g/mol2-Chloro-5-(trifluoromethyl)phenylboronic acid
CAS:Formula:C7H5BClF3O2Purity:97%Color and Shape:White – Almost white powderMolecular weight:224.37






