CymitQuimica logo

CAS 182352-48-3

:

tert-butyl 4-hydroxy-2-oxo-2,5-dihydro-1H-pyrrole-1-carboxylate

Description:
Tert-butyl 4-hydroxy-2-oxo-2,5-dihydro-1H-pyrrole-1-carboxylate is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features a tert-butyl ester group, contributing to its hydrophobic properties and influencing its solubility in organic solvents. The presence of a hydroxy group and a carbonyl group in the structure indicates potential for hydrogen bonding and reactivity, making it a versatile intermediate in organic synthesis. Its molecular structure suggests it may exhibit biological activity, potentially serving as a scaffold for drug development. The compound is typically synthesized through specific organic reactions involving pyrrole derivatives and carboxylic acids or their derivatives. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as temperature and pH. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H13NO4
InChI:InChI=1/C9H13NO4/c1-9(2,3)14-8(13)10-5-6(11)4-7(10)12/h4,11H,5H2,1-3H3
InChI key:FUOLLMGMLYOWGP-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC(=CC1=O)O
Synonyms:
  • 1H-pyrrole-1-carboxylic acid, 2,5-dihydro-4-hydroxy-2-oxo-, 1,1-dimethylethyl ester
Found 4 products.