CAS 18237-16-6

4-(1H-indol-3-yl)butan-1-aminium chloride

Description:

4-(1H-indol-3-yl)butan-1-aminium chloride, also known by its CAS number 18237-16-6, is a quaternary ammonium compound characterized by its indole moiety, which contributes to its biological activity and potential pharmacological properties. This compound features a butyl chain linked to an indole ring, with a positively charged amine group, making it a cationic substance. It is typically encountered as a chloride salt, which enhances its solubility in polar solvents. The presence of the indole structure suggests potential interactions with biological systems, particularly in neurotransmission and receptor binding, as indole derivatives are known for their roles in various biochemical pathways. The compound may exhibit properties such as antimicrobial activity, and its quaternary ammonium nature could influence its interaction with cell membranes. Additionally, it may be used in research settings to explore its effects on cellular processes or as a precursor in the synthesis of other bioactive molecules. Safety and handling precautions should be observed due to its charged nature and potential biological effects.

Formula: C₁₂H₁₇ClN₂

InChI: InChI=1/C12H16N2.ClH/c13-8-4-3-5-10-9-14-12-7-2-1-6-11(10)12;/h1-2,6-7,9,14H,3-5,8,13H2;1H

4-(1H-Indol-3-yl)butan-1-amine hydrochloride

CAS: 18237-16-6

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClN₂

Purity: Min. 95%

Molecular weight: 224.73 g/mol

Ref: 3D-TAA23716