CymitQuimica logo

CAS 1823817-92-0

:

Benzenepropanoic acid, α-[2-(dimethylamino)ethyl]-, hydrochloride (1:1)

Description:
Benzenepropanoic acid, α-[2-(dimethylamino)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzene ring, a propanoic acid moiety, and a dimethylaminoethyl side chain. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the dimethylamino group suggests potential basicity, allowing for interactions with biological systems, particularly in terms of receptor binding or enzyme activity. The propanoic acid component contributes to its acidity, which can affect its behavior in various chemical environments. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific applications and effects would depend on further studies, including its mechanism of action, toxicity, and therapeutic potential. As with many organic compounds, proper handling and safety measures should be observed due to potential hazards associated with its chemical nature.
Formula:C13H19NO2·ClH
InChI:InChI=1S/C13H19NO2.ClH/c1-14(2)9-8-12(13(15)16)10-11-6-4-3-5-7-11;/h3-7,12H,8-10H2,1-2H3,(H,15,16);1H
InChI key:InChIKey=OUWUZSOERSPSRK-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)(CCN(C)C)C(O)=O.Cl
Synonyms:
  • Benzenepropanoic acid, α-[2-(dimethylamino)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.