CAS 1824020-12-3
:1-Methyl-2-(3-pyridinyl)-2-pyrrolidinol
Description:
1-Methyl-2-(3-pyridinyl)-2-pyrrolidinol, identified by its CAS number 1824020-12-3, is a chemical compound that features a pyrrolidine ring substituted with a methyl group and a pyridine moiety. This compound is characterized by its potential biological activity, particularly in the context of pharmacology, where it may exhibit properties relevant to neuropharmacology or other therapeutic areas. The presence of the pyridine ring contributes to its polarity and potential interactions with biological targets, while the pyrrolidine structure may influence its conformational flexibility and binding affinity. As a tertiary amine, it may participate in hydrogen bonding and other intermolecular interactions, which can affect its solubility and reactivity. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-Methyl-2-(3-pyridinyl)-2-pyrrolidinol represents a class of compounds that may hold significance in medicinal chemistry and drug development.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c1-12-7-3-5-10(12,13)9-4-2-6-11-8-9/h2,4,6,8,13H,3,5,7H2,1H3
InChI key:InChIKey=BOQRPPFUUSHFGW-UHFFFAOYSA-N
SMILES:OC1(N(C)CCC1)C=2C=CC=NC2
Synonyms:- 2-Pyrrolidinol, 1-methyl-2-(3-pyridinyl)-
- 2′-Hydroxynicotine
- 1-Methyl-2-(3-pyridinyl)-2-pyrrolidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
