CAS 182415-09-4

Piclozotan

Description:

Piclozotan is a chemical compound classified as a selective serotonin receptor antagonist, specifically targeting the 5-HT2A receptor. It is primarily investigated for its potential therapeutic applications in treating various neuropsychiatric disorders, including schizophrenia and depression. The compound is known for its ability to modulate serotonin activity in the brain, which can influence mood and perception. Piclozotan has a relatively complex molecular structure, contributing to its pharmacological properties. Its efficacy and safety profile are subjects of ongoing research, with studies focusing on its impact on cognitive function and overall mental health. As with many pharmacological agents, understanding its mechanism of action, potential side effects, and interactions with other medications is crucial for its development and clinical use. The compound's CAS number, 182415-09-4, serves as a unique identifier in chemical databases, facilitating research and regulatory processes. Overall, Piclozotan represents a promising avenue in the field of psychopharmacology, although further studies are necessary to fully elucidate its therapeutic potential.

Formula: C₂₃H₂₄ClN₃O₂

InChI: InChI=1S/C23H24ClN3O2/c24-22-17-29-21-9-2-1-7-19(21)23(28)27(22)14-6-5-13-26-15-10-18(11-16-26)20-8-3-4-12-25-20/h1-4,7-10,12,17H,5-6,11,13-16H2

InChI key: InChIKey=URMTUEWUIGOJBW-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=C(Cl)N1CCCCN3CCC(=CC3)C4=CC=CC=N4)=CC=CC2

Synonyms:

• 3-Chloro-4-[4-(3′,6′-dihydro[2,4′-bipyridin]-1′(2′H)-yl)butyl]-1,4-benzoxazepin-5(4H)-one
• Piclozotan
• 1,4-Benzoxazepin-5(4H)-one, 3-chloro-4-[4-(3′,6′-dihydro[2,4′-bipyridin]-1′(2′H)-yl)butyl]-
• SUN N4057

Piclozotan

CAS: 182415-09-4

Piclozotan (anhydrous), a 5-HT1A receptor agonist, demonstrated significant neuroprotective activity in a transient middle cerebral artery occlusion (t-MCAO)

Formula: C₂₃H₂₄ClN₃O₂

Purity: 98.59%

Color and Shape: Solid

Molecular weight: 409.91

Ref: TM-T28414