CymitQuimica logo

CAS 182438-97-7

:

9H-Fluorene-9-carboxylic acid, 9-(4-bromobutyl)-

Description:
9H-Fluorene-9-carboxylic acid, 9-(4-bromobutyl)- is an organic compound characterized by its fluorene backbone, which consists of a fused ring system that includes a phenyl group. The presence of a carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may act as a weak acid. The compound also features a 4-bromobutyl substituent, which introduces a bromine atom and a butyl chain, enhancing its hydrophobic properties and potentially influencing its reactivity and solubility in various solvents. This structure suggests that the compound may exhibit interesting chemical behavior, including potential applications in organic synthesis, materials science, or medicinal chemistry. The bromobutyl group can also serve as a site for further functionalization, making it a versatile intermediate in chemical reactions. Overall, the combination of the fluorene structure and the functional groups present in this compound contributes to its unique chemical properties and potential applications in various fields.
Formula:C18H17BrO2
InChI:InChI=1S/C18H17BrO2/c19-12-6-5-11-18(17(20)21)15-9-3-1-7-13(15)14-8-2-4-10-16(14)18/h1-4,7-10H,5-6,11-12H2,(H,20,21)
InChI key:RPMAAHFLBOQCMZ-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C3=CC=CC=C3C2(CCCCBr)C(=O)O
Found 3 products.