CymitQuimica logo

CAS 18244-08-1

:

3-CHLOROISOBUTYLDIMETHYLMETHOXYSILANE

Description:
3-Chloroisobutyldimethylmethoxysilane is an organosilicon compound characterized by its silane functional group, which includes a silicon atom bonded to organic groups and a chlorine atom. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. It is often used as a coupling agent or a surface modifier in various applications, including coatings, adhesives, and sealants, enhancing adhesion between organic materials and inorganic substrates. The methoxy group allows for hydrolysis and subsequent condensation reactions, leading to the formation of siloxane networks. Additionally, its isobutyl group contributes to its hydrophobic properties, making it suitable for applications in moisture-sensitive environments. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation to skin and eyes. Overall, 3-chloroisobutyldimethyldimethoxysilane is valued for its versatility in enhancing material properties in various industrial applications.
Formula:C7H17ClOSi
InChI:InChI=1/C7H17ClOSi/c1-7(5-8)6-10(3,4)9-2/h7H,5-6H2,1-4H3
SMILES:CC(CCl)C[Si](C)(C)OC
Synonyms:
  • (3-Chloro-2-Methyl-Propyl)-Methoxy-Dimethyl-Silane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.