CAS 18246-33-8
:N-Aminoethyl-Aza-2,2,4-Trimethylsilacyclopentane
Description:
N-Aminoethyl-Aza-2,2,4-Trimethylsilacyclopentane, with the CAS number 18246-33-8, is a chemical compound that features a unique silacyclopentane structure, incorporating both nitrogen and silicon elements. This compound is characterized by the presence of an aminoethyl group, which contributes to its reactivity and potential applications in various chemical processes. The silacyclopentane framework provides a stable cyclic structure, while the trimethylsilane groups enhance its hydrophobic properties. This compound may exhibit interesting properties such as solubility in organic solvents and potential interactions with other functional groups due to the amino functionality. Its unique structure makes it a candidate for use in materials science, particularly in the development of silane-based polymers or as a precursor in the synthesis of more complex molecules. Additionally, the presence of nitrogen may impart biological activity, making it of interest in medicinal chemistry. Overall, N-Aminoethyl-Aza-2,2,4-Trimethylsilacyclopentane represents a versatile compound with potential applications across various fields of chemistry.
Formula:C8H20N2Si
InChI:InChI=1/C8H20N2Si/c1-8-6-10(5-4-9)11(2,3)7-8/h8H,4-7,9H2,1-3H3
SMILES:CC1CN(CCN)[Si](C)(C)C1
Synonyms:- 2-(2,2,4-Trimethylazasilolidin-1-Yl)Ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

