CAS 182482-25-3
:(2,4,6-Trifluorophenyl)boronic acid
Description:
(2,4,6-Trifluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a trifluorinated phenyl ring. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, owing to the boronic acid moiety. The trifluoromethyl groups on the phenyl ring enhance its electron-withdrawing properties, which can influence its reactivity and interactions in chemical reactions, particularly in Suzuki coupling reactions, where it serves as a key reagent for forming carbon-carbon bonds. The presence of fluorine atoms also contributes to its unique electronic properties, making it useful in various applications, including medicinal chemistry and materials science. Additionally, (2,4,6-Trifluorophenyl)boronic acid can participate in complexation with diols, which is significant for its role in biological systems and sensor applications. Overall, its distinctive structure and reactivity make it a valuable compound in synthetic organic chemistry.
Formula:C6H4BF3O2
InChI:InChI=1S/C6H4BF3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,11-12H
InChI key:InChIKey=IPEIGKHHSZFAEW-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(F)C=C(F)C=C1F
Synonyms:- (2,4,6-Trifluorophenyl)boronic acid
- 2,4,6-Trifluorophenylboronic acid
- 2,4,6-Trifluorophenylboronicacid
- B-(2,4,6-Trifluorophenyl)boronic acid
- Boronic acid, (2,4,6-trifluorophenyl)-
- Boronic acid, B-(2,4,6-trifluorophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,4,6-Trifluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H4BF3O2Color and Shape:White to Light yellow to Light red powder to crystalMolecular weight:175.902,4,6-Trifluorobenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H4BF3O2Purity:97%Color and Shape:Crystals or powder or crystalline powder, White to creamMolecular weight:175.90Boronic acid, B-(2,4,6-trifluorophenyl)-
CAS:Formula:C6H4BF3O2Purity:95%Color and Shape:SolidMolecular weight:175.90102,4,6-Trifluorobenzeneboronic acid
CAS:2,4,6-Trifluorobenzeneboronic acidFormula:C6H4BF3O2Purity:≥95%Color and Shape: white crystalline powderMolecular weight:175.90g/mol2,4,6-Trifluorophenylboronic acid
CAS:Formula:C6H4BF3O2Purity:95%Color and Shape:SolidMolecular weight:175.9






