CymitQuimica logo

CAS 18249-68-8

:

2-(5-bromofuran-2-yl)-1H-benzimidazole

Description:
2-(5-Bromofuran-2-yl)-1H-benzimidazole is an organic compound characterized by its unique structure, which combines a benzimidazole moiety with a furan ring substituted by a bromine atom. This compound typically exhibits properties associated with both heterocyclic compounds and aromatic systems, such as stability and potential reactivity due to the presence of the bromine substituent. The furan ring contributes to its electron-rich character, which can enhance its reactivity in electrophilic substitution reactions. Additionally, the benzimidazole part of the molecule is known for its biological activity, often being involved in various pharmacological applications. The presence of the bromine atom can also influence the compound's solubility, melting point, and overall chemical behavior. This compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex chemical structures. As with many organic compounds, its properties can be influenced by factors such as solvent interactions and environmental conditions.
Formula:C11H7BrN2O
InChI:InChI=1/C11H7BrN2O/c12-10-6-5-9(15-10)11-13-7-3-1-2-4-8(7)14-11/h1-6H,(H,13,14)
SMILES:c1ccc2c(c1)[nH]c(c1ccc(Br)o1)n2
Synonyms:
  • 1H-benzimidazole, 2-(5-bromo-2-furanyl)-
  • 2-(5-Bromo-2-furyl)-1H-benzimidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.