CAS 182498-32-4
:1-(2-bromophenyl)-3-(2-hydroxy-4-nitrophenyl)urea
Description:
1-(2-Bromophenyl)-3-(2-hydroxy-4-nitrophenyl)urea, with the CAS number 182498-32-4, is an organic compound characterized by its urea functional group, which is linked to two distinct aromatic rings. The presence of a bromine atom on one phenyl ring and a hydroxyl group along with a nitro group on the other ring contributes to its chemical reactivity and potential biological activity. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The hydroxyl and nitro substituents can influence its polarity and hydrogen bonding capabilities, making it of interest in various chemical and pharmaceutical applications. Additionally, the compound may exhibit specific optical properties due to the presence of the aromatic systems, which can be relevant in fields such as materials science and medicinal chemistry. Safety data should be consulted for handling and storage, as the presence of bromine and nitro groups may pose certain hazards.
Formula:C13H10BrN3O4
InChI:InChI=1/C13H10BrN3O4/c14-9-3-1-2-4-10(9)15-13(19)16-11-6-5-8(17(20)21)7-12(11)18/h1-7,18H,(H2,15,16,19)
SMILES:c1ccc(c(c1)Br)N=C(Nc1ccc(cc1O)N(=O)=O)O
Synonyms:- Urea, N-(2-bromophenyl)-N'-(2-hydroxy-4-nitrophenyl)-
- Sb 225002
- Sb225002
- 1-(2-Bromophenyl)-3-(2-hydroxy-4-nitrophenyl)urea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Urea, N-(2-bromophenyl)-N'-(2-hydroxy-4-nitrophenyl)-
CAS:Formula:C13H10BrN3O4Purity:99%Color and Shape:SolidMolecular weight:352.1402Ref: IN-DA0023XI
5gTo inquire10gTo inquire1mg50.00€5mg56.00€10mg58.00€25mg68.00€50mg80.00€100mg123.00€250mg177.00€1g313.00€SB 225002
CAS:Formula:C13H10BrN3O4Purity:>98.0%(HPLC)Color and Shape:White to Yellow to Green powder to crystalMolecular weight:352.14SB 225002
CAS:SB 225002Formula:C13H10BrN3O4Purity:>99%Color and Shape: light yellow to yellow solidMolecular weight:352.14g/molSB225002
CAS:SB225002 is a potent and selective CXCR2 antagonist inhibiting interleukin IL-8 binding to CXCR2.Formula:C13H10BrN3O4Purity:98.16% - 99.85%Color and Shape:SolidMolecular weight:352.14Ref: TM-T1955
5mg48.00€1mL*10mM (DMSO)50.00€10mg63.00€25mg120.00€50mg213.00€100mg383.00€200mg585.00€500mg888.00€SB 225002
CAS:Applications SB 225002 is a potent and selective CXCR2 antagonist with the ability to inhibit interleukin IL-8 binding to CXCR2.
References Erin, N. et al.: Breast Cancer Res. Treat., 150, 57 (2015);Formula:C13H10BrN3O4Color and Shape:YellowMolecular weight:352.14SB 225002
CAS:SB 225002 is an integrin antagonist that inhibits the interaction between neutrophils and cancer cells, thereby preventing cellular transformation. This drug blocks the binding of growth factor-β1 to integrin receptors on the surface of tumor cells, leading to the inhibition of tumor growth and metastasis. SB225002 has been shown to inhibit tumor growth in mice models by blocking a receptor activity and inducing caspase-independent cell death. SB 225002 also inhibits the binding of toll-like receptors (TLRs) to ligands such as lipopolysaccharide (LPS), which leads to less production of inflammatory cytokines and chemokines. SB 225002 has been shown to be effective against a number of different types of cancer cells, including breast, prostate, pancreatic, colon, lung, liver, bladder, and leukemia cells.Formula:C13H10BrN3O4Purity:Min. 95%Molecular weight:352.14 g/mol






