CAS 18251-36-0

6,6',7,12-tetramethoxy-2,2'-dimethylberbaman-5-ol

Description:

6,6',7,12-tetramethoxy-2,2'-dimethylberbaman-5-ol is a complex organic compound belonging to the class of alkaloids, specifically derived from the Berberis species. This substance features a tetracyclic structure characterized by multiple methoxy groups, which contribute to its solubility and reactivity. The presence of hydroxyl (-OH) and methoxy (-OCH3) functional groups enhances its potential for hydrogen bonding and influences its biological activity. Alkaloids like this compound are often studied for their pharmacological properties, including antimicrobial, anti-inflammatory, and anticancer activities. The specific arrangement of substituents on the berberine skeleton can significantly affect the compound's interaction with biological targets. Additionally, the compound's molecular weight, melting point, and solubility characteristics are essential for understanding its behavior in various chemical environments. As with many alkaloids, safety and toxicity profiles are crucial for any potential therapeutic applications. Overall, 6,6',7,12-tetramethoxy-2,2'-dimethylberbaman-5-ol represents a fascinating area of study in natural product chemistry and pharmacognosy.

Formula: C₃₈H₄₂N₂O₇

InChI: InChI=1/C38H42N2O7/c1-39-15-13-24-20-31(43-4)33-21-27(24)28(39)17-22-7-10-25(11-8-22)46-32-19-23(9-12-30(32)42-3)18-29-34-26(14-16-40(29)2)35(41)37(44-5)38(45-6)36(34)47-33/h7-12,19-21,28-29,41H,13-18H2,1-6H3

SMILES: CN1CCc2cc(c3cc2C1Cc1ccc(cc1)Oc1cc(ccc1OC)CC1c2c(CCN1C)c(c(c(c2O3)OC)OC)O)OC

Thalidezine

CAS: 18251-36-0

Formula: C₃₈H₄₂N₂O₇

Purity: 95%~99%

Molecular weight: 638.761

Ref: BP-BP1382

Thalidezine

CAS: 18251-36-0

Please enquire for more information about Thalidezine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₃₈H₄₂N₂O₇

Purity: Min. 95%

Molecular weight: 638.7 g/mol

Ref: 3D-TAA25136