CAS 18252-44-3: (1R,2S,6S,7S,8S)-1-methyl-3-methylidene-8-(propan-2-yl)tricyclo[4.4.0.0~2,7~]decane

Description:The chemical substance known as (1R,2S,6S,7S,8S)-1-methyl-3-methylidene-8-(propan-2-yl)tricyclo[4.4.0.0^2,7]decane, with the CAS number 18252-44-3, is a bicyclic compound characterized by its complex tricyclic structure. This compound features multiple stereocenters, which contribute to its specific three-dimensional arrangement and potentially influence its reactivity and interactions. The presence of a methylidene group and an isopropyl substituent indicates that it may exhibit unique chemical properties, such as specific reactivity patterns or biological activity. Tricyclic compounds often display interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the stereochemistry of this compound suggests that it may have distinct conformational isomers, which can affect its physical properties, such as boiling point and solubility. Overall, the structural complexity and stereochemical features of this compound make it a subject of interest for further research in organic chemistry and potential applications in various fields.

Formula:C₁₅H₂₄

InChI:InChI=1/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12-,13-,14+,15+/m0/s1