CAS 1825352-87-1
:2-(2,8-Dimethylimidazo[1,2-b]pyridazin-6-yl)-7-fluoro-4H-pyrido[1,2-a]pyrimidin-4-one
Description:
2-(2,8-Dimethylimidazo[1,2-b]pyridazin-6-yl)-7-fluoro-4H-pyrido[1,2-a]pyrimidin-4-one is a synthetic organic compound characterized by its complex heterocyclic structure, which incorporates multiple nitrogen-containing rings. This compound features a pyrimidinone core, which is known for its biological activity, and the presence of a fluorine atom, which can enhance its pharmacological properties. The dimethylimidazo group contributes to its potential reactivity and interaction with biological targets. Typically, compounds of this nature are investigated for their roles in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with various biological pathways. The specific arrangement of functional groups and the presence of fluorine may influence the compound's solubility, stability, and overall bioactivity. As with many heterocycles, the compound may exhibit interesting properties such as fluorescence or specific binding affinities, making it a candidate for further research in drug discovery and development.
Formula:C16H12FN5O
InChI:InChI=1S/C16H12FN5O/c1-9-5-13(20-22-7-10(2)18-16(9)22)12-6-15(23)21-8-11(17)3-4-14(21)19-12/h3-8H,1-2H3
InChI key:InChIKey=NWNRNQCUKDLGMJ-UHFFFAOYSA-N
SMILES:O=C1C=C(N=C2N1C=C(F)C=C2)C3=NN4C(C(C)=C3)=NC(C)=C4
Synonyms:- 2-(2,8-Dimethylimidazo[1,2-b]pyridazin-6-yl)-7-fluoro-4H-pyrido[1,2-a]pyrimidin-4-one
- 4H-Pyrido[1,2-a]pyrimidin-4-one, 2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-7-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
