CAS 182556-18-9
:1,4-Dihydro-1-methyl-4-oxo-3-pyridinesulfonamide
Description:
1,4-Dihydro-1-methyl-4-oxo-3-pyridinesulfonamide, with the CAS number 182556-18-9, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring that is substituted with a sulfonamide group and a ketone, contributing to its unique reactivity and properties. It typically appears as a solid or crystalline material and is characterized by its potential biological activity, which may include antimicrobial or antitumor effects, making it of interest in pharmaceutical research. The presence of the sulfonamide moiety is significant, as it often enhances solubility and bioavailability. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, 1,4-Dihydro-1-methyl-4-oxo-3-pyridinesulfonamide represents a compound with notable chemical and biological significance.
Formula:C6H8N2O3S
InChI:InChI=1S/C6H8N2O3S/c1-8-3-2-5(9)6(4-8)12(7,10)11/h2-4H,1H3,(H2,7,10,11)
InChI key:InChIKey=HTPSIFNKXNIAJZ-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1C(=O)C=CN(C)C1
Synonyms:- 1-Methyl-4-oxo-1,4-dihydropyridine-3-sulfonamide
- 3-Pyridinesulfonamide, 1,4-dihydro-1-methyl-4-oxo-
- 1,4-Dihydro-1-methyl-4-oxo-3-pyridinesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
