CAS 182558-96-9

Methyl 3-[(2-phenylethyl)amino]butanoate

Description:

Methyl 3-[(2-phenylethyl)amino]butanoate, with the CAS number 182558-96-9, is an organic compound characterized by its ester functional group and an amino group attached to a butanoate backbone. This compound features a methyl ester, which contributes to its solubility in organic solvents and potential reactivity in various chemical reactions. The presence of the 2-phenylethyl amino group introduces aromatic characteristics, which can influence its biological activity and interactions. Typically, compounds of this nature may exhibit properties such as moderate polarity, making them suitable for various applications in medicinal chemistry and organic synthesis. The structure suggests potential for interactions with biological targets, possibly leading to pharmacological effects. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, Methyl 3-[(2-phenylethyl)amino]butanoate represents a versatile structure with potential applications in drug development and chemical research.

Formula: C₁₃H₁₉NO₂

InChI: InChI=1S/C13H19NO2/c1-11(10-13(15)16-2)14-9-8-12-6-4-3-5-7-12/h3-7,11,14H,8-10H2,1-2H3

InChI key: InChIKey=IAXUABQEBZQZRK-UHFFFAOYSA-N

SMILES: C(CNC(CC(OC)=O)C)C1=CC=CC=C1

Synonyms:

• Butanoic acid, 3-[(2-phenylethyl)amino]-, methyl ester
• Methyl 3-[(2-phenylethyl)amino]butanoate

methyl 3-[(2-phenylethyl)amino]butanoate

CAS: 182558-96-9

Formula: C₁₃H₁₉NO₂

Purity: 95.0%

Molecular weight: 221.3

Ref: 10-F522867