
CAS 182570-27-0
:(3R)-3,4-Dihydro-6-methoxy-2H-1-benzopyran-3-carboxylic acid
Description:
(3R)-3,4-Dihydro-6-methoxy-2H-1-benzopyran-3-carboxylic acid is a chemical compound characterized by its benzopyran structure, which features a fused benzene and pyran ring. The presence of a methoxy group at the 6-position and a carboxylic acid functional group at the 3-position contributes to its reactivity and solubility properties. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its functional groups. The stereochemistry indicated by the (3R) designation suggests that it has specific spatial arrangements that can influence its biological activity and interactions. Compounds of this type may exhibit various pharmacological properties, making them of interest in medicinal chemistry. Additionally, the presence of the carboxylic acid group suggests potential for forming salts or esters, which can further modify its properties for applications in drug formulation or synthesis. Overall, this compound's unique structure and functional groups make it a subject of interest in both research and potential therapeutic applications.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c1-14-9-2-3-10-7(5-9)4-8(6-15-10)11(12)13/h2-3,5,8H,4,6H2,1H3,(H,12,13)/t8-/m1/s1
InChI key:InChIKey=YFYLMFXPYODSEB-MRVPVSSYSA-N
SMILES:C(O)(=O)[C@@H]1CC=2C(=CC=C(OC)C2)OC1
Synonyms:- (r)-6-Methoxychroman-3-carboxylic acid
- (3R)-3,4-Dihydro-6-methoxy-2H-1-benzopyran-3-carboxylic acid
- 2H-1-Benzopyran-3-carboxylic acid, 3,4-dihydro-6-methoxy-, (3R)-
- (-)-6-Methoxychroman-3-carboxylic acid
- (3R)-6-Methoxy-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.