CAS 1826-11-5

2-Phenylthiazole

Description:

2-Phenylthiazole is an organic compound characterized by a thiazole ring fused with a phenyl group. Its molecular structure consists of a five-membered heterocyclic ring containing both sulfur and nitrogen atoms, contributing to its unique chemical properties. This compound typically appears as a yellow to brown solid and is known for its aromatic characteristics due to the presence of the phenyl group. 2-Phenylthiazole is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. It exhibits biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound can participate in various chemical reactions, including electrophilic substitutions and nucleophilic additions, due to the reactivity of the thiazole ring. Its derivatives are often explored for potential applications in medicinal chemistry, particularly for their antimicrobial and antifungal properties. Overall, 2-Phenylthiazole serves as a valuable building block in organic synthesis and a subject of research in chemical and biological studies.

Formula: C₉H₇NS

InChI: InChI=1/C9H7NS/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-7H

SMILES: c1ccc(cc1)c1nccs1

Synonyms:

• 2-Phenyl-1,3-thiazole
• Thiazole, 2-phenyl-

Thiazole, 2-​phenyl-

CAS: 1826-11-5

Formula: C₉H₇NS

Purity: 96%

Color and Shape: Liquid

Molecular weight: 161.2236

Ref: IN-DA002405

2-Phenylthiazole

CAS: 1826-11-5

2-Phenylthiazole

Purity: 97%

Molecular weight: 161.22g/mol

Ref: 54-OR903003

2-Phenylthiazole

CAS: 1826-11-5

Formula: C₉H₇NS

Purity: >98.0%(GC)

Color and Shape: Colorless to Yellow clear liquid

Molecular weight: 161.22

Ref: 3B-P3197

2-Phenylthiazole

CAS: 1826-11-5

2-Phenylthiazole is an antimicrobial agent that can be used to treat bowel diseases. It has been shown to have antifungal activity in vitro against Candida albicans, and has also been shown to inhibit choroidal neovascularization. 2-Phenylthiazole has a hydroxyl group on its chemical structure which can be oxidized by hydrochloric acid into a thiocyanate ion, which is the active form of the drug. The pharmacokinetic properties of 2-phenylthiazole are not well known, but it is likely that this drug binds to human proteins such as acetylcholinesterase. 2-Phenylthiazole coordinates with nitrogen atoms in the same way as other thiocarbamates, through a dative covalent bond. This bond is stabilized by three hydrogen bonds between the oxygen atom of the carbonyl group and two nitrogen atoms from

Formula: C₉H₇NS

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 161.22 g/mol

Ref: 3D-FP156339

2-Phenylthiazole

CAS: 1826-11-5

Formula: C₉H₇NS

Purity: 96%

Color and Shape: Liquid

Molecular weight: 161.22

Ref: 10-F045798