CymitQuimica logo

CAS 1826-13-7

:

Thiazole,5-phenyl-

Description:
Thiazole, 5-phenyl- is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a phenyl group at the 5-position of the thiazole ring enhances its chemical properties, making it a valuable compound in various chemical applications. This compound typically exhibits a range of biological activities, which can include antimicrobial and antifungal properties, making it of interest in pharmaceutical research. Thiazole derivatives are often utilized in the synthesis of agrochemicals and dyes due to their ability to participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions. The compound is generally stable under standard conditions but may undergo reactions typical of thiazole derivatives, such as electrophilic aromatic substitution. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, thiazole, 5-phenyl- is a significant compound in organic chemistry with diverse applications.
Formula:C9H7NS
InChI:InChI=1S/C9H7NS/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-7H
InChI key:ZLLOWHFKKIOINR-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1cncs1
Synonyms:
  • 5-Phenylthiazole
Found 4 products.