CAS 1826-21-7
:4-(4-Methoxyphenyl)thiazole
Description:
4-(4-Methoxyphenyl)thiazole, with the CAS number 1826-21-7, is an organic compound characterized by the presence of both a thiazole ring and a methoxy-substituted phenyl group. The thiazole moiety contributes to its heterocyclic nature, which often imparts unique chemical reactivity and biological activity. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic and heteroaromatic characteristics. The methoxy group enhances its lipophilicity and can influence its interaction with biological targets. 4-(4-Methoxyphenyl)thiazole is of interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anti-inflammatory activities. Its structural features allow for various synthetic modifications, making it a versatile building block in drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methoxy group and the thiazole ring, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, this compound serves as a valuable subject of study in both synthetic and medicinal chemistry.
Formula:C10H9NOS
InChI:InChI=1S/C10H9NOS/c1-12-9-4-2-8(3-5-9)10-6-13-7-11-10/h2-7H,1H3
InChI key:InChIKey=VOWXAMZJYPLGFZ-UHFFFAOYSA-N
SMILES:O(C)C1=CC=C(C=C1)C2=CSC=N2
Synonyms:- 4-(4-Methoxyphenyl)-1,3-Thiazole
- 4-(4-Methoxyphenyl)thiazole
- Thiazole, 4-(4-methoxyphenyl)-
- Thiazole, 4-(p-methoxyphenyl)-
- 4-(4-METHOXY-PHENYL)-THIAZOLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
