
CAS 18261-99-9
:2,3-Bis(acetyloxy)butanedioic acid
Description:
2,3-Bis(acetyloxy)butanedioic acid, also known by its CAS number 18261-99-9, is an organic compound characterized by the presence of two acetyloxy groups attached to a butanedioic acid backbone. This compound features a symmetrical structure with two carboxylic acid functional groups, which contribute to its acidity and potential reactivity. The acetyloxy groups enhance its solubility in organic solvents and may influence its reactivity in various chemical processes. Typically, compounds like this are utilized in organic synthesis, potentially serving as intermediates in the production of more complex molecules. The presence of multiple functional groups allows for diverse chemical transformations, making it a valuable compound in synthetic organic chemistry. Additionally, its properties may include moderate stability under standard conditions, but it could be sensitive to hydrolysis, particularly in the presence of water or moisture, leading to the release of acetic acid. Overall, 2,3-Bis(acetyloxy)butanedioic acid is a versatile compound with applications in various chemical fields.
Formula:C8H10O8
InChI:InChI=1S/C8H10O8/c1-3(9)15-5(7(11)12)6(8(13)14)16-4(2)10/h5-6H,1-2H3,(H,11,12)(H,13,14)
InChI key:InChIKey=DNISEZBAYYIQFB-UHFFFAOYSA-N
SMILES:C(C(OC(C)=O)C(O)=O)(OC(C)=O)C(O)=O
Synonyms:- 2,3-Diacetoxysuccinic acid
- Butanedioic acid, 2,3-bis(acetyloxy)-
- 2,3-Bis(acetyloxy)butanedioic acid
- Tartaric acid, diacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
