CAS 18263-25-7
:2-Bromohexadecanoic acid
Description:
2-Bromohexadecanoic acid is a long-chain fatty acid derivative characterized by the presence of a bromine atom at the second carbon position of the hexadecanoic acid backbone. This compound typically exhibits properties common to fatty acids, such as being a solid at room temperature due to its long hydrophobic carbon chain. It is soluble in organic solvents but has limited solubility in water, reflecting its amphiphilic nature. The bromine substitution can influence its reactivity, making it a useful intermediate in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. The presence of the bromine atom can also affect the compound's biological activity, including its interactions with biological membranes and enzymes. Additionally, 2-bromohexadecanoic acid may be utilized in various applications, including surfactants and emulsifiers, due to its ability to modify surface properties. As with many halogenated compounds, safety precautions should be taken when handling it, as brominated compounds can pose environmental and health risks.
Formula:C16H31BrO2
InChI:InChI=1/C16H31BrO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15H,2-14H2,1H3,(H,18,19)/t15-/m0/s1
InChI key:InChIKey=DPRAYRYQQAXQPE-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCC)CC(C(O)=O)Br
Synonyms:- (2S)-2-bromohexadecanoic acid
- 1-Bromopentadecanecarboxylic acid
- 2-BROMOHEXADECANOIC ACID (2-Bromopalmitic Acid)
- 2-Bromo-Hexadecanoicaci
- 2-Bromo-n-hexadecanoic acid
- 2-Bromopalmitate
- 2-Bromopalmitic Acid
- <span class="text-smallcaps">DL</span>-2-Bromopalmitate
- A-Bromopalmitic Acid
- Alpha-Bromopalmitate
- Bromohexadecanoicacid
- Hexadecanoic acid, 2-bromo-
- NSC 58378
- 2-Bromohexadecanoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Bromopalmitic Acid (2-Bromohexadecanoic acid)
CAS:Saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides etc, nesoiFormula:C16H31BrO2Color and Shape:White PowderMolecular weight:334.150742-Bromohexadecanoic acid
CAS:2-Bromohexadecanoic acid (2-BP) is a PPARδ agonist, and a palmitoylation inhibitor, inhibiting DHHC-mediated palmitoylation. Cost-effective and quality-assured.
Formula:C16H31BrO2Purity:97% - 98.3%Color and Shape:White Crystalline PowderMolecular weight:335.322-Bromohexadecanoic acid
CAS:2-Bromohexadecanoic acidFormula:C16H31BrO2Purity:97%Color and Shape: white powderMolecular weight:335.32g/mol2-Bromopalmitic Acid
CAS:Controlled ProductFormula:C16H31BrO2Color and Shape:NeatMolecular weight:335.32







