
CAS 18265-49-1
:4-Amino-1-β-D-lyxofuranosyl-2(1H)-pyrimidinone
Description:
4-Amino-1-β-D-lyxofuranosyl-2(1H)-pyrimidinone, with the CAS number 18265-49-1, is a nucleoside analog that features a pyrimidinone base linked to a sugar moiety. This compound is characterized by the presence of an amino group at the 4-position of the pyrimidinone ring, which contributes to its biological activity. The β-D-lyxofuranosyl sugar component is a five-membered ring structure that plays a crucial role in the stability and solubility of the molecule. This compound is of interest in medicinal chemistry and biochemistry due to its potential applications in antiviral and anticancer therapies, as it may interfere with nucleic acid synthesis. Its structural features allow it to mimic natural nucleosides, which can lead to incorporation into RNA or DNA, potentially disrupting normal cellular processes. The compound's solubility, stability, and reactivity are influenced by its functional groups and the stereochemistry of the sugar, making it a subject of study for drug development and therapeutic applications.
Formula:C9H13N3O5
InChI:InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6+,7+,8-/m1/s1
InChI key:InChIKey=UHDGCWIWMRVCDJ-YDKYIBAVSA-N
SMILES:O[C@@H]1[C@@H](O[C@H](CO)[C@@H]1O)N2C(=O)N=C(N)C=C2
Synonyms:- 1-β-D-Lyxofuranosylcytosine
- 2(1H)-Pyrimidinone, 4-amino-1-β-D-lyxofuranosyl-
- 4-Amino-1-β-D-lyxofuranosyl-2(1H)-pyrimidinone
- Cytosine, 1-β-D-lyxofuranosyl-
- Cytarabine Impurity 4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
