CAS 18267-91-9
:1-phenyl-2-(propylamino)butan-1-one hydrochloride (1:1)
Description:
1-Phenyl-2-(propylamino)butan-1-one hydrochloride, with the CAS number 18267-91-9, is a chemical compound that belongs to the class of substituted phenyl ketones. It is characterized by the presence of a phenyl group attached to a butanone backbone, along with a propylamino substituent. This compound typically appears as a white to off-white crystalline solid and is soluble in water and organic solvents, which is common for hydrochloride salts. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amine functional group that can participate in various chemical reactions. The hydrochloride form enhances its stability and solubility, making it more suitable for biological studies. As with many chemical substances, handling should be done with care, following appropriate safety protocols, as it may exhibit biological activity or toxicity. Further research is often necessary to fully understand its pharmacological properties and potential uses in therapeutic applications.
Formula:C13H20ClNO
InChI:InChI=1/C13H19NO.ClH/c1-3-10-14-12(4-2)13(15)11-8-6-5-7-9-11;/h5-9,12,14H,3-4,10H2,1-2H3;1H
SMILES:CCCNC(CC)C(=O)c1ccccc1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-phenyl-2-(propylamino)-1-Butanone Hydrochloride
CAS:Controlled Product<p>Applications 1-phenyl-2-(propylamino)-1-Butanone Hydrochloride is a α-Aminoketone derivatives and a useful building block.<br>References Koeppe, H.; et al.: DE 1493461 (1972).<br></p>Formula:C13H19NO·HClColor and Shape:NeatMolecular weight:241.76
