CymitQuimica logo

CAS 18268-16-1

:

2-(ethylamino)-1-phenylpentan-1-one hydrochloride (1:1)

Description:
2-(Ethylamino)-1-phenylpentan-1-one hydrochloride, with the CAS number 18268-16-1, is a chemical compound that belongs to the class of substituted phenylalkylamines. It typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is characteristic of many hydrochloride salts. The compound features a phenyl group attached to a pentanone backbone, with an ethylamino substituent, contributing to its potential biological activity. Its structure suggests it may interact with neurotransmitter systems, although specific pharmacological properties would depend on further empirical studies. As with many compounds in this class, it may be subject to regulatory scrutiny due to its potential for misuse or abuse. Proper handling and safety precautions are essential, as with all chemical substances, to mitigate risks associated with exposure.
Formula:C13H20ClNO
InChI:InChI=1/C13H19NO.ClH/c1-3-8-12(14-4-2)13(15)11-9-6-5-7-10-11;/h5-7,9-10,12,14H,3-4,8H2,1-2H3;1H
SMILES:CCCC(C(=O)c1ccccc1)NCC.Cl
Found 2 products.