CymitQuimica logo

CAS 1827-97-0

:

2,2,2-trifluoroethanesulfonic acid

Description:
2,2,2-Trifluoroethanesulfonic acid, also known as trifluoroethanesulfonic acid or TFESA, is a strong organic acid characterized by its trifluoromethyl group attached to the ethyl chain, which significantly enhances its acidity compared to non-fluorinated sulfonic acids. It is a colorless to pale yellow liquid that is highly soluble in water and polar organic solvents, making it useful in various chemical applications. The presence of the sulfonic acid functional group contributes to its strong acidic properties, allowing it to act as a proton donor in chemical reactions. TFESA is often utilized as a reagent in organic synthesis, particularly in the preparation of fluorinated compounds, and as a catalyst in various chemical processes. Additionally, its unique properties make it valuable in the development of ionic liquids and as a potential electrolyte in electrochemical applications. However, due to its strong acidity and potential environmental impact, handling requires appropriate safety precautions.
Formula:C2H3F3O3S
InChI:InChI=1/C2H3F3O3S/c3-2(4,5)1-9(6,7)8/h1H2,(H,6,7,8)
SMILES:C(C(F)(F)F)S(=O)(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.