CAS 18274-81-2
:desmethylanethol trithione
Description:
Desmethylanethol trithione, identified by its CAS number 18274-81-2, is a chemical compound that belongs to the class of thiones, which are sulfur-containing analogs of ketones. This substance is characterized by the presence of multiple sulfur atoms in its structure, contributing to its unique chemical properties. Thiones typically exhibit reactivity due to the presence of the sulfur atom, which can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Desmethylanethol trithione may also display specific physical properties such as solubility in organic solvents, which is common for thione compounds. Its applications can range from use in organic synthesis to potential roles in biological systems, although specific applications may vary. As with many chemical substances, safety and handling precautions are essential, as thiones can exhibit toxicity or environmental hazards. Overall, desmethylanethol trithione is a compound of interest in both synthetic and applied chemistry contexts, warranting further investigation into its properties and potential uses.
Formula:C9H6OS3
InChI:InChI=1/C9H6OS3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5,11H
SMILES:C1=CC(=O)C=CC1=C1C=C(S)SS1
Synonyms:- 4-Hydroxyanethole trithione
- Desmethyl-adt
- Desmethylanethol dithiolthione
- 3H-1,2-Dithiole-3-thione, 5-(4-hydroxyphenyl)-
- 4-(5-sulfanyl-3H-1,2-dithiol-3-ylidene)cyclohexa-2,5-dien-1-one
- Desmethylanethol trithione
- 5-(4-hydroxyphenyl)-3H-1,2-dithiole-3-thione
- 5-(4-hydroxyphenyl)dithiole-3-thione
- Anethole impurity 2
- Adt-Oh
- Anethole Trithione impurity 2
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3H-1,2-Dithiole-3-thione, 5-(4-hydroxyphenyl)-
CAS:Formula:C9H6OS3Purity:97%Color and Shape:SolidMolecular weight:226.33835-(4-Hydroxyphenyl)-3H-1,2-Dithiole-3-Thione
CAS:5-(4-Hydroxyphenyl)-3H-1,2-Dithiole-3-ThionePurity:97%Molecular weight:226.34g/molDesmethylanethol trithione
CAS:Desmethylanethol trithione (ADT-OH), a synthetic H2S donor, modulates tPA effects, reduces stroke damage, and improves recovery in mice.
Formula:C9H6OS3Purity:98.05% - 98.41%Color and Shape:SolidMolecular weight:226.345-(4-Hydroxyphenyl)-3H-1,2-dithiole-3-thione
CAS:Formula:C9H6OS3Purity:97%Color and Shape:SolidMolecular weight:226.33





