CAS 18278-29-0
:(1E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one
Description:
(1E)-1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one, with the CAS number 18278-29-0, is an organic compound characterized by its structure, which features a penta-1,4-dien-3-one backbone substituted with two 4-chlorophenyl groups. This compound exhibits a conjugated system due to the presence of double bonds, which can contribute to its electronic properties and potential reactivity. The chlorophenyl substituents enhance its lipophilicity and may influence its biological activity, making it of interest in various fields, including medicinal chemistry and materials science. The compound is likely to be a solid at room temperature and may exhibit distinct color properties due to its conjugated system. Its reactivity can be attributed to the presence of the carbonyl group, which can participate in various chemical reactions, such as nucleophilic additions. Additionally, the compound's stability and solubility characteristics can vary based on the solvent used, and it may have specific applications in organic synthesis or as a potential pharmaceutical agent.
Formula:C17H12Cl2O
InChI:InChI=1/C17H12Cl2O/c18-15-7-1-13(2-8-15)5-11-17(20)12-6-14-3-9-16(19)10-4-14/h1-12H/b11-5+,12-6u
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(1E,4E)-1,5-Bis(4-Chlorophenyl)Penta-1,4-Dien-3-One
CAS:(1E,4E)-1,5-Bis(4-Chlorophenyl)Penta-1,4-Dien-3-OnePurity:98%Molecular weight:303.18g/mol1,5-Di(4-Chlorophenyl)penta-1,4-dien-3-one
CAS:1,5-Di(4-chlorophenyl)penta-1,4-dien-3-one is a chromophore that has been extensively studied for its vibrational and optical properties. This compound has shown biological activity in the form of antitumor activity, as well as an ability to inhibit radiation and carcinogenesis. The optical properties of 1,5-di(4-chlorophenyl)penta-1,4-dien-3-one are determined by its polarizability and carbonyl group. Further research is needed to determine the functional theory and techniques used to study this compound's optical properties.Formula:C17H12Cl2OPurity:Min. 95%Molecular weight:303.18 g/mol



